C12H23FOSi — CID 15339851
trans-(2R,6R)-2-[tert-butyl(dimethyl)silyl]-6-fluorocyclohexan-1-one (PubChem CID 15339851) has the molecular formula C12H23FOSi and a molecular weight of 230.40 g/mol. Its IUPAC name is trans-(2R,6R)-2-[tert-butyl(dimethyl)silyl]-6-fluorocyclohexan-1-one.
| Compound Name | trans-(2R,6R)-2-[tert-butyl(dimethyl)silyl]-6-fluorocyclohexan-1-one |
|---|---|
| PubChem CID | 15339851 |
| Molecular Formula | C12H23FOSi |
| Molecular Weight | 230.40 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | trans-(2R,6R)-2-[tert-butyl(dimethyl)silyl]-6-fluorocyclohexan-1-one |
| SMILES | CC(C)(C)[Si](C)(C)[C@@H]1CCC[C@@H](F)C1=O |
| InChI | InChI=1S/C12H23FOSi/c1-12(2,3)15(4,5)10-8-6-7-9(13)11(10)14/h9-10H,6-8H2,1-5H3/t9-,10-/m1/s1 |
| InChIKey | BDPSGXKEQRAKFL-NXEZZACHSA-N |
| XLogP | 3.96 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.40 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|