C13H27FOSi — CID 15339845
(3R,5S)-3-[tert-butyl(dimethyl)silyl]-5-fluoroheptan-4-one (PubChem CID 15339845) has the molecular formula C13H27FOSi and a molecular weight of 246.44 g/mol. Its IUPAC name is (3R,5S)-3-[tert-butyl(dimethyl)silyl]-5-fluoroheptan-4-one.
| Compound Name | (3R,5S)-3-[tert-butyl(dimethyl)silyl]-5-fluoroheptan-4-one |
|---|---|
| PubChem CID | 15339845 |
| Molecular Formula | C13H27FOSi |
| Molecular Weight | 246.44 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | (3R,5S)-3-[tert-butyl(dimethyl)silyl]-5-fluoroheptan-4-one |
| SMILES | CC[C@H](C(=O)[C@@H](F)CC)[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H27FOSi/c1-8-10(14)12(15)11(9-2)16(6,7)13(3,4)5/h10-11H,8-9H2,1-7H3/t10-,11+/m0/s1 |
| InChIKey | YMQFFCSHTUDZTF-WDEREUQCSA-N |
| XLogP | 4.59 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.44 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|