C14H29FOSi — CID 15522422
(2S,4R)-2-[tert-butyl(dimethyl)silyl]-4-fluoro-6-methylheptan-3-one (PubChem CID 15522422) has the molecular formula C14H29FOSi and a molecular weight of 260.47 g/mol. Its IUPAC name is (2S,4R)-2-[tert-butyl(dimethyl)silyl]-4-fluoro-6-methylheptan-3-one.
| Compound Name | (2S,4R)-2-[tert-butyl(dimethyl)silyl]-4-fluoro-6-methylheptan-3-one |
|---|---|
| PubChem CID | 15522422 |
| Molecular Formula | C14H29FOSi |
| Molecular Weight | 260.47 g/mol |
| Exact Mass | 260.20 |
| IUPAC Name | (2S,4R)-2-[tert-butyl(dimethyl)silyl]-4-fluoro-6-methylheptan-3-one |
| SMILES | CC(C)C[C@@H](F)C(=O)[C@H](C)[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H29FOSi/c1-10(2)9-12(15)13(16)11(3)17(7,8)14(4,5)6/h10-12H,9H2,1-8H3/t11-,12+/m0/s1 |
| InChIKey | DWFSMKYUNDWPTM-NWDGAFQWSA-N |
| XLogP | 4.84 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.47 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|