C13H25FOSi — CID 11746886
trans-(2R,7R)-2-[tert-butyl(dimethyl)silyl]-7-fluorocycloheptan-1-one (PubChem CID 11746886) has the molecular formula C13H25FOSi and a molecular weight of 244.43 g/mol. Its IUPAC name is trans-(2R,7R)-2-[tert-butyl(dimethyl)silyl]-7-fluorocycloheptan-1-one.
| Compound Name | trans-(2R,7R)-2-[tert-butyl(dimethyl)silyl]-7-fluorocycloheptan-1-one |
|---|---|
| PubChem CID | 11746886 |
| Molecular Formula | C13H25FOSi |
| Molecular Weight | 244.43 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | trans-(2R,7R)-2-[tert-butyl(dimethyl)silyl]-7-fluorocycloheptan-1-one |
| SMILES | CC(C)(C)[Si](C)(C)[C@@H]1CCCC[C@@H](F)C1=O |
| InChI | InChI=1S/C13H25FOSi/c1-13(2,3)16(4,5)11-9-7-6-8-10(14)12(11)15/h10-11H,6-9H2,1-5H3/t10-,11-/m1/s1 |
| InChIKey | XHHNHCPIZCJPCB-GHMZBOCLSA-N |
| XLogP | 4.35 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.43 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|