C13H25IOSi — CID 15355398
trans-(2R,7R)-2-[tert-butyl(dimethyl)silyl]-7-iodocycloheptan-1-one (PubChem CID 15355398) has the molecular formula C13H25IOSi and a molecular weight of 352.33 g/mol. Its IUPAC name is trans-(2R,7R)-2-[tert-butyl(dimethyl)silyl]-7-iodocycloheptan-1-one.
| Compound Name | trans-(2R,7R)-2-[tert-butyl(dimethyl)silyl]-7-iodocycloheptan-1-one |
|---|---|
| PubChem CID | 15355398 |
| Molecular Formula | C13H25IOSi |
| Molecular Weight | 352.33 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | trans-(2R,7R)-2-[tert-butyl(dimethyl)silyl]-7-iodocycloheptan-1-one |
| SMILES | CC(C)(C)[Si](C)(C)[C@@H]1CCCC[C@@H](I)C1=O |
| InChI | InChI=1S/C13H25IOSi/c1-13(2,3)16(4,5)11-9-7-6-8-10(14)12(11)15/h10-11H,6-9H2,1-5H3/t10-,11-/m1/s1 |
| InChIKey | LQJRUGNNRJMAFY-GHMZBOCLSA-N |
| XLogP | 4.81 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.33 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|