C13H27IOSi — CID 100982662
(3R,5R)-3-[tert-butyl(dimethyl)silyl]-5-iodoheptan-4-one (PubChem CID 100982662) has the molecular formula C13H27IOSi and a molecular weight of 354.35 g/mol. Its IUPAC name is (3R,5R)-3-[tert-butyl(dimethyl)silyl]-5-iodoheptan-4-one.
| Compound Name | (3R,5R)-3-[tert-butyl(dimethyl)silyl]-5-iodoheptan-4-one |
|---|---|
| PubChem CID | 100982662 |
| Molecular Formula | C13H27IOSi |
| Molecular Weight | 354.35 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | (3R,5R)-3-[tert-butyl(dimethyl)silyl]-5-iodoheptan-4-one |
| SMILES | CC[C@@H](I)C(=O)[C@@H](CC)[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H27IOSi/c1-8-10(14)12(15)11(9-2)16(6,7)13(3,4)5/h10-11H,8-9H2,1-7H3/t10-,11-/m1/s1 |
| InChIKey | PWBDHYISDZNKKQ-GHMZBOCLSA-N |
| XLogP | 5.06 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.35 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|