C22H35N3O3 — CID 153398561
1-[2-[(3S,5R)-3,5-dimethyl-4-[5-(2-methylpropanoyl)-2-pyridinyl]piperazin-1-yl]ethoxy]-3-methylbutan-2-one (PubChem CID 153398561) has the molecular formula C22H35N3O3 and a molecular weight of 389.54 g/mol. Its IUPAC name is 1-[2-[(3S,5R)-3,5-dimethyl-4-[5-(2-methylpropanoyl)-2-pyridinyl]piperazin-1-yl]ethoxy]-3-methylbutan-2-one.
| Compound Name | 1-[2-[(3S,5R)-3,5-dimethyl-4-[5-(2-methylpropanoyl)-2-pyridinyl]piperazin-1-yl]ethoxy]-3-methylbutan-2-one |
|---|---|
| PubChem CID | 153398561 |
| Molecular Formula | C22H35N3O3 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.27 |
| IUPAC Name | 1-[2-[(3S,5R)-3,5-dimethyl-4-[5-(2-methylpropanoyl)-2-pyridinyl]piperazin-1-yl]ethoxy]-3-methylbutan-2-one |
| SMILES | CC(C)C(=O)COCCN1C[C@@H](C)N(c2ccc(C(=O)C(C)C)cn2)[C@@H](C)C1 |
| InChI | InChI=1S/C22H35N3O3/c1-15(2)20(26)14-28-10-9-24-12-17(5)25(18(6)13-24)21-8-7-19(11-23-21)22(27)16(3)4/h7-8,11,15-18H,9-10,12-14H2,1-6H3/t17-,18+ |
| InChIKey | ITFLPZWDGJTNNM-HDICACEKSA-N |
| XLogP | 3.06 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|