C16H20N4O2 — CID 153398932
ethane;8-[2-(hydroxymethyl)morpholin-4-yl]quinoxaline-5-carbonitrile (PubChem CID 153398932) has the molecular formula C16H20N4O2 and a molecular weight of 300.36 g/mol. Its IUPAC name is ethane;8-[2-(hydroxymethyl)morpholin-4-yl]quinoxaline-5-carbonitrile.
| Compound Name | ethane;8-[2-(hydroxymethyl)morpholin-4-yl]quinoxaline-5-carbonitrile |
|---|---|
| PubChem CID | 153398932 |
| Molecular Formula | C16H20N4O2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | ethane;8-[2-(hydroxymethyl)morpholin-4-yl]quinoxaline-5-carbonitrile |
| SMILES | CC.N#Cc1ccc(N2CCOC(CO)C2)c2nccnc12 |
| InChI | InChI=1S/C14H14N4O2.C2H6/c15-7-10-1-2-12(14-13(10)16-3-4-17-14)18-5-6-20-11(8-18)9-19;1-2/h1-4,11,19H,5-6,8-9H2;1-2H3 |
| InChIKey | KKNIUMUUAOYHJP-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |