C14H15ClFN5 — CID 129240614
8-(3-amino-4-fluoropiperidin-1-yl)quinoxaline-5-carbonitrile;hydrochloride (PubChem CID 129240614) has the molecular formula C14H15ClFN5 and a molecular weight of 307.76 g/mol. Its IUPAC name is 8-(3-amino-4-fluoropiperidin-1-yl)quinoxaline-5-carbonitrile;hydrochloride.
| Compound Name | 8-(3-amino-4-fluoropiperidin-1-yl)quinoxaline-5-carbonitrile;hydrochloride |
|---|---|
| PubChem CID | 129240614 |
| Molecular Formula | C14H15ClFN5 |
| Molecular Weight | 307.76 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 8-(3-amino-4-fluoropiperidin-1-yl)quinoxaline-5-carbonitrile;hydrochloride |
| SMILES | Cl.N#Cc1ccc(N2CCC(F)C(N)C2)c2nccnc12 |
| InChI | InChI=1S/C14H14FN5.ClH/c15-10-3-6-20(8-11(10)17)12-2-1-9(7-16)13-14(12)19-5-4-18-13;/h1-2,4-5,10-11H,3,6,8,17H2;1H |
| InChIKey | CBKBOGQGBIXQEA-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 78.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.76 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |