C13H24N2O — CID 153399051
N-[(2S)-butan-2-yl]-2-(3-methyl-3-azabicyclo[3.1.1]heptan-6-yl)acetamide (PubChem CID 153399051) has the molecular formula C13H24N2O and a molecular weight of 224.35 g/mol. Its IUPAC name is N-[(2S)-butan-2-yl]-2-(3-methyl-3-azabicyclo[3.1.1]heptan-6-yl)acetamide.
| Compound Name | N-[(2S)-butan-2-yl]-2-(3-methyl-3-azabicyclo[3.1.1]heptan-6-yl)acetamide |
|---|---|
| PubChem CID | 153399051 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | N-[(2S)-butan-2-yl]-2-(3-methyl-3-azabicyclo[3.1.1]heptan-6-yl)acetamide |
| SMILES | CC[C@H](C)NC(=O)CC1C2CC1CN(C)C2 |
| InChI | InChI=1S/C13H24N2O/c1-4-9(2)14-13(16)6-12-10-5-11(12)8-15(3)7-10/h9-12H,4-8H2,1-3H3,(H,14,16)/t9-,10?,11?,12?/m0/s1 |
| InChIKey | RQYPKMVUIVTWAP-ZLMIFYAYSA-N |
| XLogP | 1.49 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |