C11H24N4O — CID 83022308
N-butan-2-yl-2-[(4-methylpiperazin-1-yl)amino]acetamide (PubChem CID 83022308) has the molecular formula C11H24N4O and a molecular weight of 228.34 g/mol. Its IUPAC name is N-butan-2-yl-2-[(4-methylpiperazin-1-yl)amino]acetamide.
| Compound Name | N-butan-2-yl-2-[(4-methylpiperazin-1-yl)amino]acetamide |
|---|---|
| PubChem CID | 83022308 |
| Molecular Formula | C11H24N4O |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.20 |
| IUPAC Name | N-butan-2-yl-2-[(4-methylpiperazin-1-yl)amino]acetamide |
| SMILES | CCC(C)NC(=O)CNN1CCN(C)CC1 |
| InChI | InChI=1S/C11H24N4O/c1-4-10(2)13-11(16)9-12-15-7-5-14(3)6-8-15/h10,12H,4-9H2,1-3H3,(H,13,16) |
| InChIKey | KGFDIQQPUHFKFG-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |