C44H62N2O4 — CID 153399580
6-(2-hydroxyethylamino)-3-[18-[4-(2-hydroxyethylamino)-2,6,6-trimethyl-3-oxocyclohexen-1-yl]-3,7,12,16-tetramethyloctadeca-1,3,5,7,9,11,13,15,17-nonaenyl]-2,4,4-trimethylcyclohex-2-en-1-one (PubChem CID 153399580) has the molecular formula C44H62N2O4 and a molecular weight of 682.99 g/mol. Its IUPAC name is 6-(2-hydroxyethylamino)-3-[18-[4-(2-hydroxyethylamino)-2,6,6-trimethyl-3-oxocyclohexen-1-yl]-3,7,12,16-tetramethyloctadeca-1,3,5,7,9,11,13,15,17-nonaenyl]-2,4,4-trimethylcyclohex-2-en-1-one.
| Compound Name | 6-(2-hydroxyethylamino)-3-[18-[4-(2-hydroxyethylamino)-2,6,6-trimethyl-3-oxocyclohexen-1-yl]-3,7,12,16-tetramethyloctadeca-1,3,5,7,9,11,13,15,17-nonaenyl]-2,4,4-trimethylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 153399580 |
| Molecular Formula | C44H62N2O4 |
| Molecular Weight | 682.99 g/mol |
| Exact Mass | 682.47 |
| IUPAC Name | 6-(2-hydroxyethylamino)-3-[18-[4-(2-hydroxyethylamino)-2,6,6-trimethyl-3-oxocyclohexen-1-yl]-3,7,12,16-tetramethyloctadeca-1,3,5,7,9,11,13,15,17-nonaenyl]-2,4,4-trimethylcyclohex-2-en-1-one |
| SMILES | CC(C=CC=C(C)C=CC1=C(C)C(=O)C(NCCO)CC1(C)C)=CC=CC=C(C)C=CC=C(C)C=CC1=C(C)C(=O)C(NCCO)CC1(C)C |
| InChI | InChI=1S/C44H62N2O4/c1-31(17-13-19-33(3)21-23-37-35(5)41(49)39(45-25-27-47)29-43(37,7)8)15-11-12-16-32(2)18-14-20-34(4)22-24-38-36(6)42(50)40(46-26-28-48)30-44(38,9)10/h11-24,39-40,45-48H,25-30H2,1-10H3 |
| InChIKey | UCWLPKSMLMAVBP-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.99 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|