About but-1-ene;molecular hydrogen;N-propan-2-ylmethanimine
but-1-ene;molecular hydrogen;N-propan-2-ylmethanimine (PubChem CID 153399985) has the molecular formula C8H19N
and a molecular weight of 129.25 g/mol. Its IUPAC name is but-1-ene;molecular hydrogen;N-propan-2-ylmethanimine.
Molecular Properties
| Compound Name | but-1-ene;molecular hydrogen;N-propan-2-ylmethanimine |
| PubChem CID | 153399985 |
| Molecular Formula | C8H19N |
| Molecular Weight | 129.25 g/mol |
| Exact Mass | 129.15 |
| IUPAC Name | but-1-ene;molecular hydrogen;N-propan-2-ylmethanimine |
| SMILES | C=CCC.C=NC(C)C.[H][H] |
| InChI | InChI=1S/C4H9N.C4H8.H2/c1-4(2)5-3;1-3-4-2;/h4H,3H2,1-2H3;3H,1,4H2,2H3;1H |
| InChIKey | FJJFJUKZVLSOHL-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.25 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze but-1-ene;molecular hydrogen;N-propan-2-ylmethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-1-ene;molecular hydrogen;N-propan-2-ylmethanimine?
The IUPAC name of but-1-ene;molecular hydrogen;N-propan-2-ylmethanimine (CID 153399985) is but-1-ene;molecular hydrogen;N-propan-2-ylmethanimine.
What is the SMILES notation for but-1-ene;molecular hydrogen;N-propan-2-ylmethanimine?
The canonical SMILES for but-1-ene;molecular hydrogen;N-propan-2-ylmethanimine is C=CCC.C=NC(C)C.[H][H].
What is the InChIKey of but-1-ene;molecular hydrogen;N-propan-2-ylmethanimine?
The InChIKey is FJJFJUKZVLSOHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9N.C4H8.H2/c1-4(2)5-3;1-3-4-2;/h4H,3H2,1-2H3;3H,1,4H2,2H3;1H.
What are the key properties of but-1-ene;molecular hydrogen;N-propan-2-ylmethanimine?
but-1-ene;molecular hydrogen;N-propan-2-ylmethanimine has a molecular weight of 129.25 g/mol, XLogP of 2.92, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for but-1-ene;molecular hydrogen;N-propan-2-ylmethanimine is sourced from PubChem (CID 153399985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).