C17H21N — CID 153400153
1-naphthalen-2-ylethanamine;(3Z)-penta-1,3-diene (PubChem CID 153400153) has the molecular formula C17H21N and a molecular weight of 239.36 g/mol. Its IUPAC name is 1-naphthalen-2-ylethanamine;(3Z)-penta-1,3-diene.
| Compound Name | 1-naphthalen-2-ylethanamine;(3Z)-penta-1,3-diene |
|---|---|
| PubChem CID | 153400153 |
| Molecular Formula | C17H21N |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | 1-naphthalen-2-ylethanamine;(3Z)-penta-1,3-diene |
| SMILES | C=C/C=C\C.CC(N)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C12H13N.C5H8/c1-9(13)11-7-6-10-4-2-3-5-12(10)8-11;1-3-5-4-2/h2-9H,13H2,1H3;3-5H,1H2,2H3/b;5-4- |
| InChIKey | NMFUZWSKPWRUDJ-GUHKXDMSSA-N |
| XLogP | 4.61 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|