About 1-naphthalen-2-ylethanamine;(3Z)-penta-1,3-diene
1-naphthalen-2-ylethanamine;(3Z)-penta-1,3-diene (PubChem CID 153400153) has the molecular formula C17H21N
and a molecular weight of 239.36 g/mol. Its IUPAC name is 1-naphthalen-2-ylethanamine;(3Z)-penta-1,3-diene.
Molecular Properties
| Compound Name | 1-naphthalen-2-ylethanamine;(3Z)-penta-1,3-diene |
| PubChem CID | 153400153 |
| Molecular Formula | C17H21N |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | 1-naphthalen-2-ylethanamine;(3Z)-penta-1,3-diene |
| SMILES | C=C/C=C\C.CC(N)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C12H13N.C5H8/c1-9(13)11-7-6-10-4-2-3-5-12(10)8-11;1-3-5-4-2/h2-9H,13H2,1H3;3-5H,1H2,2H3/b;5-4- |
| InChIKey | NMFUZWSKPWRUDJ-GUHKXDMSSA-N |
| XLogP | 4.61 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-naphthalen-2-ylethanamine;(3Z)-penta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-naphthalen-2-ylethanamine;(3Z)-penta-1,3-diene?
The IUPAC name of 1-naphthalen-2-ylethanamine;(3Z)-penta-1,3-diene (CID 153400153) is 1-naphthalen-2-ylethanamine;(3Z)-penta-1,3-diene.
What is the SMILES notation for 1-naphthalen-2-ylethanamine;(3Z)-penta-1,3-diene?
The canonical SMILES for 1-naphthalen-2-ylethanamine;(3Z)-penta-1,3-diene is C=C/C=C\C.CC(N)c1ccc2ccccc2c1.
What is the InChIKey of 1-naphthalen-2-ylethanamine;(3Z)-penta-1,3-diene?
The InChIKey is NMFUZWSKPWRUDJ-GUHKXDMSSA-N. The full InChI is InChI=1S/C12H13N.C5H8/c1-9(13)11-7-6-10-4-2-3-5-12(10)8-11;1-3-5-4-2/h2-9H,13H2,1H3;3-5H,1H2,2H3/b;5-4-.
What are the key properties of 1-naphthalen-2-ylethanamine;(3Z)-penta-1,3-diene?
1-naphthalen-2-ylethanamine;(3Z)-penta-1,3-diene has a molecular weight of 239.36 g/mol, XLogP of 4.61, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-naphthalen-2-ylethanamine;(3Z)-penta-1,3-diene is sourced from PubChem (CID 153400153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).