C22H37NO — CID 153400817
2-[(17S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methyliminoethanol (PubChem CID 153400817) has the molecular formula C22H37NO and a molecular weight of 331.54 g/mol. Its IUPAC name is 2-[(17S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methyliminoethanol.
| Compound Name | 2-[(17S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methyliminoethanol |
|---|---|
| PubChem CID | 153400817 |
| Molecular Formula | C22H37NO |
| Molecular Weight | 331.54 g/mol |
| Exact Mass | 331.29 |
| IUPAC Name | 2-[(17S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methyliminoethanol |
| SMILES | C/N=C(\CO)[C@H]1CCC2C3CCC4CCCCC4(C)C3CCC21C |
| InChI | InChI=1S/C22H37NO/c1-21-12-5-4-6-15(21)7-8-16-17-9-10-19(20(14-24)23-3)22(17,2)13-11-18(16)21/h15-19,24H,4-14H2,1-3H3/b23-20+/t15?,16?,17?,18?,19-,21?,22?/m1/s1 |
| InChIKey | MLWTWJRHMHFSOA-RAEHWONTSA-N |
| XLogP | 5.10 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.54 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|