C28H37N3O5 — CID 153402480
3-(hydroxymethyl)-3H-indole-2-carboxamide;3-[4-(4-piperidin-4-ylbutoxy)phenyl]propanoic acid (PubChem CID 153402480) has the molecular formula C28H37N3O5 and a molecular weight of 495.62 g/mol. Its IUPAC name is 3-(hydroxymethyl)-3H-indole-2-carboxamide;3-[4-(4-piperidin-4-ylbutoxy)phenyl]propanoic acid.
| Compound Name | 3-(hydroxymethyl)-3H-indole-2-carboxamide;3-[4-(4-piperidin-4-ylbutoxy)phenyl]propanoic acid |
|---|---|
| PubChem CID | 153402480 |
| Molecular Formula | C28H37N3O5 |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.27 |
| IUPAC Name | 3-(hydroxymethyl)-3H-indole-2-carboxamide;3-[4-(4-piperidin-4-ylbutoxy)phenyl]propanoic acid |
| SMILES | NC(=O)C1=Nc2ccccc2C1CO.O=C(O)CCc1ccc(OCCCCC2CCNCC2)cc1 |
| InChI | InChI=1S/C18H27NO3.C10H10N2O2/c20-18(21)9-6-16-4-7-17(8-5-16)22-14-2-1-3-15-10-12-19-13-11-15;11-10(14)9-7(5-13)6-3-1-2-4-8(6)12-9/h4-5,7-8,15,19H,1-3,6,9-14H2,(H,20,21);1-4,7,13H,5H2,(H2,11,14) |
| InChIKey | JMWOZICVKUWTMG-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 134.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|