C27H33N3O6S — CID 163750315
(2S)-3-[4-(4-piperidin-4-ylbutoxy)phenyl]-2-[(3-sulfino-3H-indole-2-carbonyl)amino]propanoic acid (PubChem CID 163750315) has the molecular formula C27H33N3O6S and a molecular weight of 527.64 g/mol. Its IUPAC name is (2S)-3-[4-(4-piperidin-4-ylbutoxy)phenyl]-2-[(3-sulfino-3H-indole-2-carbonyl)amino]propanoic acid.
| Compound Name | (2S)-3-[4-(4-piperidin-4-ylbutoxy)phenyl]-2-[(3-sulfino-3H-indole-2-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 163750315 |
| Molecular Formula | C27H33N3O6S |
| Molecular Weight | 527.64 g/mol |
| Exact Mass | 527.21 |
| IUPAC Name | (2S)-3-[4-(4-piperidin-4-ylbutoxy)phenyl]-2-[(3-sulfino-3H-indole-2-carbonyl)amino]propanoic acid |
| SMILES | O=C(N[C@@H](Cc1ccc(OCCCCC2CCNCC2)cc1)C(=O)O)C1=Nc2ccccc2C1S(=O)O |
| InChI | InChI=1S/C27H33N3O6S/c31-26(24-25(37(34)35)21-6-1-2-7-22(21)29-24)30-23(27(32)33)17-19-8-10-20(11-9-19)36-16-4-3-5-18-12-14-28-15-13-18/h1-2,6-11,18,23,25,28H,3-5,12-17H2,(H,30,31)(H,32,33)(H,34,35)/t23-,25?/m0/s1 |
| InChIKey | ZDGYXRIURJWWBB-LFQPHHBNSA-N |
| XLogP | 3.40 |
| TPSA | 137.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.64 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|