C23H38N2O5S — CID 59922506
3-[4-(4-piperidin-4-ylbutoxy)phenyl]-2-(1-sulfinopentylamino)propanoic acid (PubChem CID 59922506) has the molecular formula C23H38N2O5S and a molecular weight of 454.63 g/mol. Its IUPAC name is 3-[4-(4-piperidin-4-ylbutoxy)phenyl]-2-(1-sulfinopentylamino)propanoic acid.
| Compound Name | 3-[4-(4-piperidin-4-ylbutoxy)phenyl]-2-(1-sulfinopentylamino)propanoic acid |
|---|---|
| PubChem CID | 59922506 |
| Molecular Formula | C23H38N2O5S |
| Molecular Weight | 454.63 g/mol |
| Exact Mass | 454.25 |
| IUPAC Name | 3-[4-(4-piperidin-4-ylbutoxy)phenyl]-2-(1-sulfinopentylamino)propanoic acid |
| SMILES | CCCCC(NC(Cc1ccc(OCCCCC2CCNCC2)cc1)C(=O)O)S(=O)O |
| InChI | InChI=1S/C23H38N2O5S/c1-2-3-7-22(31(28)29)25-21(23(26)27)17-19-8-10-20(11-9-19)30-16-5-4-6-18-12-14-24-15-13-18/h8-11,18,21-22,24-25H,2-7,12-17H2,1H3,(H,26,27)(H,28,29) |
| InChIKey | PUDSKSASKHRMNH-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.63 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|