C28H35N3O4S — CID 170274231
ethyl 2-(1,3-benzothiazole-2-carbonylamino)-3-[4-(4-piperidin-4-ylbutoxy)phenyl]propanoate (PubChem CID 170274231) has the molecular formula C28H35N3O4S and a molecular weight of 509.67 g/mol. Its IUPAC name is ethyl 2-(1,3-benzothiazole-2-carbonylamino)-3-[4-(4-piperidin-4-ylbutoxy)phenyl]propanoate.
| Compound Name | ethyl 2-(1,3-benzothiazole-2-carbonylamino)-3-[4-(4-piperidin-4-ylbutoxy)phenyl]propanoate |
|---|---|
| PubChem CID | 170274231 |
| Molecular Formula | C28H35N3O4S |
| Molecular Weight | 509.67 g/mol |
| Exact Mass | 509.23 |
| IUPAC Name | ethyl 2-(1,3-benzothiazole-2-carbonylamino)-3-[4-(4-piperidin-4-ylbutoxy)phenyl]propanoate |
| SMILES | CCOC(=O)C(Cc1ccc(OCCCCC2CCNCC2)cc1)NC(=O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C28H35N3O4S/c1-2-34-28(33)24(30-26(32)27-31-23-8-3-4-9-25(23)36-27)19-21-10-12-22(13-11-21)35-18-6-5-7-20-14-16-29-17-15-20/h3-4,8-13,20,24,29H,2,5-7,14-19H2,1H3,(H,30,32) |
| InChIKey | IMLRVDMWGZTJKG-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.67 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|