C30H42N3O6P — CID 126579719
(2S)-2-[[ethoxy-[2-(1H-indol-3-yl)ethoxy]phosphoryl]amino]-3-[4-(4-piperidin-4-ylbutoxy)phenyl]propanoic acid (PubChem CID 126579719) has the molecular formula C30H42N3O6P and a molecular weight of 571.66 g/mol. Its IUPAC name is (2S)-2-[[ethoxy-[2-(1H-indol-3-yl)ethoxy]phosphoryl]amino]-3-[4-(4-piperidin-4-ylbutoxy)phenyl]propanoic acid.
| Compound Name | (2S)-2-[[ethoxy-[2-(1H-indol-3-yl)ethoxy]phosphoryl]amino]-3-[4-(4-piperidin-4-ylbutoxy)phenyl]propanoic acid |
|---|---|
| PubChem CID | 126579719 |
| Molecular Formula | C30H42N3O6P |
| Molecular Weight | 571.66 g/mol |
| Exact Mass | 571.28 |
| IUPAC Name | (2S)-2-[[ethoxy-[2-(1H-indol-3-yl)ethoxy]phosphoryl]amino]-3-[4-(4-piperidin-4-ylbutoxy)phenyl]propanoic acid |
| SMILES | CCOP(=O)(N[C@@H](Cc1ccc(OCCCCC2CCNCC2)cc1)C(=O)O)OCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C30H42N3O6P/c1-2-38-40(36,39-20-16-25-22-32-28-9-4-3-8-27(25)28)33-29(30(34)35)21-24-10-12-26(13-11-24)37-19-6-5-7-23-14-17-31-18-15-23/h3-4,8-13,22-23,29,31-32H,2,5-7,14-21H2,1H3,(H,33,36)(H,34,35)/t29-,40?/m0/s1 |
| InChIKey | XKUGHUWFAPEGHH-CNNPJYHGSA-N |
| XLogP | 5.71 |
| TPSA | 121.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.66 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|