C27H35N3O6S — CID 122192350
(2S)-2-[(4-methoxyphenyl)sulfonylamino]-3-[5-(4-piperidin-4-ylbutoxy)-1H-indol-3-yl]propanoic acid (PubChem CID 122192350) has the molecular formula C27H35N3O6S and a molecular weight of 529.66 g/mol. Its IUPAC name is (2S)-2-[(4-methoxyphenyl)sulfonylamino]-3-[5-(4-piperidin-4-ylbutoxy)-1H-indol-3-yl]propanoic acid.
| Compound Name | (2S)-2-[(4-methoxyphenyl)sulfonylamino]-3-[5-(4-piperidin-4-ylbutoxy)-1H-indol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 122192350 |
| Molecular Formula | C27H35N3O6S |
| Molecular Weight | 529.66 g/mol |
| Exact Mass | 529.22 |
| IUPAC Name | (2S)-2-[(4-methoxyphenyl)sulfonylamino]-3-[5-(4-piperidin-4-ylbutoxy)-1H-indol-3-yl]propanoic acid |
| SMILES | COc1ccc(S(=O)(=O)N[C@@H](Cc2c[nH]c3ccc(OCCCCC4CCNCC4)cc23)C(=O)O)cc1 |
| InChI | InChI=1S/C27H35N3O6S/c1-35-21-5-8-23(9-6-21)37(33,34)30-26(27(31)32)16-20-18-29-25-10-7-22(17-24(20)25)36-15-3-2-4-19-11-13-28-14-12-19/h5-10,17-19,26,28-30H,2-4,11-16H2,1H3,(H,31,32)/t26-/m0/s1 |
| InChIKey | BSERWEBAQIXJHI-SANMLTNESA-N |
| XLogP | 3.70 |
| TPSA | 129.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.66 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|