C27H34ClN3O6S — CID 134153267
2-[(4-methoxyphenyl)sulfonylamino]-3-[6-(3-piperazin-1-ylpropoxy)naphthalen-2-yl]propanoic acid;hydrochloride (PubChem CID 134153267) has the molecular formula C27H34ClN3O6S and a molecular weight of 564.10 g/mol. Its IUPAC name is 2-[(4-methoxyphenyl)sulfonylamino]-3-[6-(3-piperazin-1-ylpropoxy)naphthalen-2-yl]propanoic acid;hydrochloride.
| Compound Name | 2-[(4-methoxyphenyl)sulfonylamino]-3-[6-(3-piperazin-1-ylpropoxy)naphthalen-2-yl]propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 134153267 |
| Molecular Formula | C27H34ClN3O6S |
| Molecular Weight | 564.10 g/mol |
| Exact Mass | 563.19 |
| IUPAC Name | 2-[(4-methoxyphenyl)sulfonylamino]-3-[6-(3-piperazin-1-ylpropoxy)naphthalen-2-yl]propanoic acid;hydrochloride |
| SMILES | COc1ccc(S(=O)(=O)NC(Cc2ccc3cc(OCCCN4CCNCC4)ccc3c2)C(=O)O)cc1.Cl |
| InChI | InChI=1S/C27H33N3O6S.ClH/c1-35-23-7-9-25(10-8-23)37(33,34)29-26(27(31)32)18-20-3-4-22-19-24(6-5-21(22)17-20)36-16-2-13-30-14-11-28-12-15-30;/h3-10,17,19,26,28-29H,2,11-16,18H2,1H3,(H,31,32);1H |
| InChIKey | GGAMTWWXAKELEY-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.10 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|