C34H50N6O5S — CID 20663624
2-[[2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-3-sulfanylpropanoyl]amino]-3-phenyl-N-[1-[4-(4-piperidin-4-ylbutoxy)phenyl]propan-2-yl]propanamide (PubChem CID 20663624) has the molecular formula C34H50N6O5S and a molecular weight of 654.88 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-3-sulfanylpropanoyl]amino]-3-phenyl-N-[1-[4-(4-piperidin-4-ylbutoxy)phenyl]propan-2-yl]propanamide.
| Compound Name | 2-[[2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-3-sulfanylpropanoyl]amino]-3-phenyl-N-[1-[4-(4-piperidin-4-ylbutoxy)phenyl]propan-2-yl]propanamide |
|---|---|
| PubChem CID | 20663624 |
| Molecular Formula | C34H50N6O5S |
| Molecular Weight | 654.88 g/mol |
| Exact Mass | 654.36 |
| IUPAC Name | 2-[[2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-3-sulfanylpropanoyl]amino]-3-phenyl-N-[1-[4-(4-piperidin-4-ylbutoxy)phenyl]propan-2-yl]propanamide |
| SMILES | CC(Cc1ccc(OCCCCC2CCNCC2)cc1)NC(=O)C(Cc1ccccc1)NC(=O)C(CS)NC(=O)CNC(=O)CN |
| InChI | InChI=1S/C34H50N6O5S/c1-24(19-27-10-12-28(13-11-27)45-18-6-5-7-25-14-16-36-17-15-25)38-33(43)29(20-26-8-3-2-4-9-26)40-34(44)30(23-46)39-32(42)22-37-31(41)21-35/h2-4,8-13,24-25,29-30,36,46H,5-7,14-23,35H2,1H3,(H,37,41)(H,38,43)(H,39,42)(H,40,44) |
| InChIKey | RYYPYPVXABWTGV-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 163.68 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.88 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|