C33H37NO5 — CID 71733828
(2S)-3-[4-(3-cyclohexylpropoxy)phenyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (PubChem CID 71733828) has the molecular formula C33H37NO5 and a molecular weight of 527.66 g/mol. Its IUPAC name is (2S)-3-[4-(3-cyclohexylpropoxy)phenyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid.
| Compound Name | (2S)-3-[4-(3-cyclohexylpropoxy)phenyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
|---|---|
| PubChem CID | 71733828 |
| Molecular Formula | C33H37NO5 |
| Molecular Weight | 527.66 g/mol |
| Exact Mass | 527.27 |
| IUPAC Name | (2S)-3-[4-(3-cyclohexylpropoxy)phenyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| SMILES | O=C(N[C@@H](Cc1ccc(OCCCC2CCCCC2)cc1)C(=O)O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C33H37NO5/c35-32(36)31(21-24-16-18-25(19-17-24)38-20-8-11-23-9-2-1-3-10-23)34-33(37)39-22-30-28-14-6-4-12-26(28)27-13-5-7-15-29(27)30/h4-7,12-19,23,30-31H,1-3,8-11,20-22H2,(H,34,37)(H,35,36)/t31-/m0/s1 |
| InChIKey | KAFVRAFAVOVPJE-HKBQPEDESA-N |
| XLogP | 6.96 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.66 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|