C56H50N2O6 — CID 132519411
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[4-[6-[4-(1,2,2-triphenylethenyl)phenoxy]hexanoylamino]phenyl]propanoic acid (PubChem CID 132519411) has the molecular formula C56H50N2O6 and a molecular weight of 847.02 g/mol. Its IUPAC name is (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[4-[6-[4-(1,2,2-triphenylethenyl)phenoxy]hexanoylamino]phenyl]propanoic acid.
| Compound Name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[4-[6-[4-(1,2,2-triphenylethenyl)phenoxy]hexanoylamino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 132519411 |
| Molecular Formula | C56H50N2O6 |
| Molecular Weight | 847.02 g/mol |
| Exact Mass | 846.37 |
| IUPAC Name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[4-[6-[4-(1,2,2-triphenylethenyl)phenoxy]hexanoylamino]phenyl]propanoic acid |
| SMILES | O=C(CCCCCOc1ccc(C(=C(c2ccccc2)c2ccccc2)c2ccccc2)cc1)Nc1ccc(C[C@H](NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)O)cc1 |
| InChI | InChI=1S/C56H50N2O6/c59-52(57-44-32-28-39(29-33-44)37-51(55(60)61)58-56(62)64-38-50-48-25-14-12-23-46(48)47-24-13-15-26-49(47)50)27-11-4-16-36-63-45-34-30-43(31-35-45)54(42-21-9-3-10-22-42)53(40-17-5-1-6-18-40)41-19-7-2-8-20-41/h1-3,5-10,12-15,17-26,28-35,50-51H,4,11,16,27,36-38H2,(H,57,59)(H,58,62)(H,60,61)/t51-/m0/s1 |
| InChIKey | DCUGLUGPTDRTAO-XHIZWQFQSA-N |
| XLogP | 11.81 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 847.02 |
| LogP ≤ 5 | 11.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|