C36H35NO6 — CID 102511696
phenacyl (2S)-3-(4-butoxyphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate (PubChem CID 102511696) has the molecular formula C36H35NO6 and a molecular weight of 577.68 g/mol. Its IUPAC name is phenacyl (2S)-3-(4-butoxyphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate.
| Compound Name | phenacyl (2S)-3-(4-butoxyphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 102511696 |
| Molecular Formula | C36H35NO6 |
| Molecular Weight | 577.68 g/mol |
| Exact Mass | 577.25 |
| IUPAC Name | phenacyl (2S)-3-(4-butoxyphenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate |
| SMILES | CCCCOc1ccc(C[C@H](NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)OCC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C36H35NO6/c1-2-3-21-41-27-19-17-25(18-20-27)22-33(35(39)42-24-34(38)26-11-5-4-6-12-26)37-36(40)43-23-32-30-15-9-7-13-28(30)29-14-8-10-16-31(29)32/h4-20,32-33H,2-3,21-24H2,1H3,(H,37,40)/t33-/m0/s1 |
| InChIKey | TWPKVJFRKFLWKL-XIFFEERXSA-N |
| XLogP | 6.74 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.68 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|