C17H18ClF4NO2 — CID 153403255
tert-butyl 2-[2-(chloromethyl)-1,3,3,3-tetrafluoropropyl]indole-1-carboxylate (PubChem CID 153403255) has the molecular formula C17H18ClF4NO2 and a molecular weight of 379.78 g/mol. Its IUPAC name is tert-butyl 2-[2-(chloromethyl)-1,3,3,3-tetrafluoropropyl]indole-1-carboxylate.
| Compound Name | tert-butyl 2-[2-(chloromethyl)-1,3,3,3-tetrafluoropropyl]indole-1-carboxylate |
|---|---|
| PubChem CID | 153403255 |
| Molecular Formula | C17H18ClF4NO2 |
| Molecular Weight | 379.78 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | tert-butyl 2-[2-(chloromethyl)-1,3,3,3-tetrafluoropropyl]indole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1c(C(F)C(CCl)C(F)(F)F)cc2ccccc21 |
| InChI | InChI=1S/C17H18ClF4NO2/c1-16(2,3)25-15(24)23-12-7-5-4-6-10(12)8-13(23)14(19)11(9-18)17(20,21)22/h4-8,11,14H,9H2,1-3H3 |
| InChIKey | GNNQYKIUFDZHBB-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.78 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|