About 4-[(Z,3E)-1-amino-3-(1-ethoxybutylimino)prop-1-en-2-yl]cyclohexan-1-amine
4-[(Z,3E)-1-amino-3-(1-ethoxybutylimino)prop-1-en-2-yl]cyclohexan-1-amine (PubChem CID 153404787) has the molecular formula C15H29N3O
and a molecular weight of 267.42 g/mol. Its IUPAC name is 4-[(Z,3E)-1-amino-3-(1-ethoxybutylimino)prop-1-en-2-yl]cyclohexan-1-amine.
Molecular Properties
| Compound Name | 4-[(Z,3E)-1-amino-3-(1-ethoxybutylimino)prop-1-en-2-yl]cyclohexan-1-amine |
| PubChem CID | 153404787 |
| Molecular Formula | C15H29N3O |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.23 |
| IUPAC Name | 4-[(Z,3E)-1-amino-3-(1-ethoxybutylimino)prop-1-en-2-yl]cyclohexan-1-amine |
| SMILES | CCCC(/N=C/C(=C\N)C1CCC(N)CC1)OCC |
| InChI | InChI=1S/C15H29N3O/c1-3-5-15(19-4-2)18-11-13(10-16)12-6-8-14(17)9-7-12/h10-12,14-15H,3-9,16-17H2,1-2H3/b13-10+,18-11+ |
| InChIKey | FOEXXAZWXLCINA-HWVXOFFASA-N |
| XLogP | 2.58 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[(Z,3E)-1-amino-3-(1-ethoxybutylimino)prop-1-en-2-yl]cyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(Z,3E)-1-amino-3-(1-ethoxybutylimino)prop-1-en-2-yl]cyclohexan-1-amine?
The IUPAC name of 4-[(Z,3E)-1-amino-3-(1-ethoxybutylimino)prop-1-en-2-yl]cyclohexan-1-amine (CID 153404787) is 4-[(Z,3E)-1-amino-3-(1-ethoxybutylimino)prop-1-en-2-yl]cyclohexan-1-amine.
What is the SMILES notation for 4-[(Z,3E)-1-amino-3-(1-ethoxybutylimino)prop-1-en-2-yl]cyclohexan-1-amine?
The canonical SMILES for 4-[(Z,3E)-1-amino-3-(1-ethoxybutylimino)prop-1-en-2-yl]cyclohexan-1-amine is CCCC(/N=C/C(=C\N)C1CCC(N)CC1)OCC.
What is the InChIKey of 4-[(Z,3E)-1-amino-3-(1-ethoxybutylimino)prop-1-en-2-yl]cyclohexan-1-amine?
The InChIKey is FOEXXAZWXLCINA-HWVXOFFASA-N. The full InChI is InChI=1S/C15H29N3O/c1-3-5-15(19-4-2)18-11-13(10-16)12-6-8-14(17)9-7-12/h10-12,14-15H,3-9,16-17H2,1-2H3/b13-10+,18-11+.
What are the key properties of 4-[(Z,3E)-1-amino-3-(1-ethoxybutylimino)prop-1-en-2-yl]cyclohexan-1-amine?
4-[(Z,3E)-1-amino-3-(1-ethoxybutylimino)prop-1-en-2-yl]cyclohexan-1-amine has a molecular weight of 267.42 g/mol, XLogP of 2.58, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(Z,3E)-1-amino-3-(1-ethoxybutylimino)prop-1-en-2-yl]cyclohexan-1-amine is sourced from PubChem (CID 153404787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).