C10H19N3 — CID 153404773
4-[(Z)-1-amino-3-methyliminoprop-1-en-2-yl]cyclohexan-1-amine (PubChem CID 153404773) has the molecular formula C10H19N3 and a molecular weight of 181.28 g/mol. Its IUPAC name is 4-[(Z)-1-amino-3-methyliminoprop-1-en-2-yl]cyclohexan-1-amine.
| Compound Name | 4-[(Z)-1-amino-3-methyliminoprop-1-en-2-yl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 153404773 |
| Molecular Formula | C10H19N3 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.16 |
| IUPAC Name | 4-[(Z)-1-amino-3-methyliminoprop-1-en-2-yl]cyclohexan-1-amine |
| SMILES | C/N=C/C(=C\N)C1CCC(N)CC1 |
| InChI | InChI=1S/C10H19N3/c1-13-7-9(6-11)8-2-4-10(12)5-3-8/h6-8,10H,2-5,11-12H2,1H3/b9-6+,13-7+ |
| InChIKey | BMROFWFCFBIPSS-KTKDNUBYSA-N |
| XLogP | 1.05 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|