C12H23F2N3 — CID 153404945
4-[(Z,3E)-1-amino-3-(difluoromethylimino)prop-1-en-2-yl]cyclohexan-1-amine;ethane (PubChem CID 153404945) has the molecular formula C12H23F2N3 and a molecular weight of 247.33 g/mol. Its IUPAC name is 4-[(Z,3E)-1-amino-3-(difluoromethylimino)prop-1-en-2-yl]cyclohexan-1-amine;ethane.
| Compound Name | 4-[(Z,3E)-1-amino-3-(difluoromethylimino)prop-1-en-2-yl]cyclohexan-1-amine;ethane |
|---|---|
| PubChem CID | 153404945 |
| Molecular Formula | C12H23F2N3 |
| Molecular Weight | 247.33 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | 4-[(Z,3E)-1-amino-3-(difluoromethylimino)prop-1-en-2-yl]cyclohexan-1-amine;ethane |
| SMILES | CC.N/C=C(\C=N\C(F)F)C1CCC(N)CC1 |
| InChI | InChI=1S/C10H17F2N3.C2H6/c11-10(12)15-6-8(5-13)7-1-3-9(14)4-2-7;1-2/h5-7,9-10H,1-4,13-14H2;1-2H3/b8-5+,15-6+; |
| InChIKey | HQAGQEDIDRFVLD-YRJNNKSXSA-N |
| XLogP | 2.67 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.33 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|