C14H28F2N2 — CID 153404595
1,1-difluoroethane;ethane;4-[(Z)-1-iminobut-2-en-2-yl]cyclohexan-1-amine (PubChem CID 153404595) has the molecular formula C14H28F2N2 and a molecular weight of 262.39 g/mol. Its IUPAC name is 1,1-difluoroethane;ethane;4-[(Z)-1-iminobut-2-en-2-yl]cyclohexan-1-amine.
| Compound Name | 1,1-difluoroethane;ethane;4-[(Z)-1-iminobut-2-en-2-yl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 153404595 |
| Molecular Formula | C14H28F2N2 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.22 |
| IUPAC Name | 1,1-difluoroethane;ethane;4-[(Z)-1-iminobut-2-en-2-yl]cyclohexan-1-amine |
| SMILES | CC.CC(F)F.[H]/N=C/C(=C\C)C1CCC(N)CC1 |
| InChI | InChI=1S/C10H18N2.C2H4F2.C2H6/c1-2-8(7-11)9-3-5-10(12)6-4-9;1-2(3)4;1-2/h2,7,9-11H,3-6,12H2,1H3;2H,1H3;1-2H3/b8-2+,11-7+;; |
| InChIKey | BMXSFBSXOCUAGU-JKGCVFNESA-N |
| XLogP | 4.40 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|