C11H19F2N3 — CID 153404764
4-[(Z)-1-amino-3-(2,2-difluoroethylimino)prop-1-en-2-yl]cyclohexan-1-amine (PubChem CID 153404764) has the molecular formula C11H19F2N3 and a molecular weight of 231.29 g/mol. Its IUPAC name is 4-[(Z)-1-amino-3-(2,2-difluoroethylimino)prop-1-en-2-yl]cyclohexan-1-amine.
| Compound Name | 4-[(Z)-1-amino-3-(2,2-difluoroethylimino)prop-1-en-2-yl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 153404764 |
| Molecular Formula | C11H19F2N3 |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.15 |
| IUPAC Name | 4-[(Z)-1-amino-3-(2,2-difluoroethylimino)prop-1-en-2-yl]cyclohexan-1-amine |
| SMILES | N/C=C(\C=N\CC(F)F)C1CCC(N)CC1 |
| InChI | InChI=1S/C11H19F2N3/c12-11(13)7-16-6-9(5-14)8-1-3-10(15)4-2-8/h5-6,8,10-11H,1-4,7,14-15H2/b9-5+,16-6+ |
| InChIKey | SKEUNSLEQMXKRF-MGEOUUDKSA-N |
| XLogP | 1.68 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|