C11H21F2N3S — CID 153404807
4-[(Z,3E)-1-amino-3-(difluoromethylimino)but-1-en-2-yl]cyclohexan-1-amine;sulfane (PubChem CID 153404807) has the molecular formula C11H21F2N3S and a molecular weight of 265.37 g/mol. Its IUPAC name is 4-[(Z,3E)-1-amino-3-(difluoromethylimino)but-1-en-2-yl]cyclohexan-1-amine;sulfane.
| Compound Name | 4-[(Z,3E)-1-amino-3-(difluoromethylimino)but-1-en-2-yl]cyclohexan-1-amine;sulfane |
|---|---|
| PubChem CID | 153404807 |
| Molecular Formula | C11H21F2N3S |
| Molecular Weight | 265.37 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | 4-[(Z,3E)-1-amino-3-(difluoromethylimino)but-1-en-2-yl]cyclohexan-1-amine;sulfane |
| SMILES | CC(=N\C(F)F)/C(=C\N)C1CCC(N)CC1.S |
| InChI | InChI=1S/C11H19F2N3.H2S/c1-7(16-11(12)13)10(6-14)8-2-4-9(15)5-3-8;/h6,8-9,11H,2-5,14-15H2,1H3;1H2/b10-6+,16-7+; |
| InChIKey | ZBMYRZLSPHRZDY-MQFMAUEWSA-N |
| XLogP | 2.14 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.37 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|