C29H31FN6O5 — CID 153406345
[3-[3-[[5-(3,6-dihydro-2H-pyran-4-yl)-2-[3-[2-(dimethylamino)ethoxy]anilino]pyrimidin-4-yl]amino]anilino]-3-oxoprop-1-en-2-yl] carbonofluoridate (PubChem CID 153406345) has the molecular formula C29H31FN6O5 and a molecular weight of 562.60 g/mol. Its IUPAC name is [3-[3-[[5-(3,6-dihydro-2H-pyran-4-yl)-2-[3-[2-(dimethylamino)ethoxy]anilino]pyrimidin-4-yl]amino]anilino]-3-oxoprop-1-en-2-yl] carbonofluoridate.
| Compound Name | [3-[3-[[5-(3,6-dihydro-2H-pyran-4-yl)-2-[3-[2-(dimethylamino)ethoxy]anilino]pyrimidin-4-yl]amino]anilino]-3-oxoprop-1-en-2-yl] carbonofluoridate |
|---|---|
| PubChem CID | 153406345 |
| Molecular Formula | C29H31FN6O5 |
| Molecular Weight | 562.60 g/mol |
| Exact Mass | 562.23 |
| IUPAC Name | [3-[3-[[5-(3,6-dihydro-2H-pyran-4-yl)-2-[3-[2-(dimethylamino)ethoxy]anilino]pyrimidin-4-yl]amino]anilino]-3-oxoprop-1-en-2-yl] carbonofluoridate |
| SMILES | C=C(OC(=O)F)C(=O)Nc1cccc(Nc2nc(Nc3cccc(OCCN(C)C)c3)ncc2C2=CCOCC2)c1 |
| InChI | InChI=1S/C29H31FN6O5/c1-19(41-28(30)38)27(37)33-22-7-4-6-21(16-22)32-26-25(20-10-13-39-14-11-20)18-31-29(35-26)34-23-8-5-9-24(17-23)40-15-12-36(2)3/h4-10,16-18H,1,11-15H2,2-3H3,(H,33,37)(H2,31,32,34,35) |
| InChIKey | NDVIVOPGMXRPLJ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 126.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.60 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|