C21H14ClNSe — CID 153406948
3-(4-chlorophenyl)-4,5-diphenyl-1,2-selenazole (PubChem CID 153406948) has the molecular formula C21H14ClNSe and a molecular weight of 394.76 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-4,5-diphenyl-1,2-selenazole.
| Compound Name | 3-(4-chlorophenyl)-4,5-diphenyl-1,2-selenazole |
|---|---|
| PubChem CID | 153406948 |
| Molecular Formula | C21H14ClNSe |
| Molecular Weight | 394.76 g/mol |
| Exact Mass | 395.00 |
| IUPAC Name | 3-(4-chlorophenyl)-4,5-diphenyl-1,2-selenazole |
| SMILES | Clc1ccc(-c2n[se]c(-c3ccccc3)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C21H14ClNSe/c22-18-13-11-16(12-14-18)20-19(15-7-3-1-4-8-15)21(24-23-20)17-9-5-2-6-10-17/h1-14H |
| InChIKey | NAGLZBUCPURERK-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.76 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|