C32H35F5O3S — CID 15340724
1-[(Z)-1,2-diphenylbut-1-enyl]-4-[5-(4,4,5,5,5-pentafluoropentylsulfonyl)pentoxy]benzene (PubChem CID 15340724) has the molecular formula C32H35F5O3S and a molecular weight of 594.69 g/mol. Its IUPAC name is 1-[(Z)-1,2-diphenylbut-1-enyl]-4-[5-(4,4,5,5,5-pentafluoropentylsulfonyl)pentoxy]benzene.
| Compound Name | 1-[(Z)-1,2-diphenylbut-1-enyl]-4-[5-(4,4,5,5,5-pentafluoropentylsulfonyl)pentoxy]benzene |
|---|---|
| PubChem CID | 15340724 |
| Molecular Formula | C32H35F5O3S |
| Molecular Weight | 594.69 g/mol |
| Exact Mass | 594.22 |
| IUPAC Name | 1-[(Z)-1,2-diphenylbut-1-enyl]-4-[5-(4,4,5,5,5-pentafluoropentylsulfonyl)pentoxy]benzene |
| SMILES | CC/C(=C(\c1ccccc1)c1ccc(OCCCCCS(=O)(=O)CCCC(F)(F)C(F)(F)F)cc1)c1ccccc1 |
| InChI | InChI=1S/C32H35F5O3S/c1-2-29(25-13-6-3-7-14-25)30(26-15-8-4-9-16-26)27-17-19-28(20-18-27)40-22-10-5-11-23-41(38,39)24-12-21-31(33,34)32(35,36)37/h3-4,6-9,13-20H,2,5,10-12,21-24H2,1H3/b30-29- |
| InChIKey | HSLARLNCRDAIFJ-FLWNBWAVSA-N |
| XLogP | 9.00 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.69 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|