C58H72F2N2S4 — CID 153408881
5,10-bis(2-ethylhexyl)-3,8-difluoro-2,7-bis[5-(5-hexylthiophen-2-yl)thiophen-2-yl]indolo[3,2-b]indole (PubChem CID 153408881) has the molecular formula C58H72F2N2S4 and a molecular weight of 963.49 g/mol. Its IUPAC name is 5,10-bis(2-ethylhexyl)-3,8-difluoro-2,7-bis[5-(5-hexylthiophen-2-yl)thiophen-2-yl]indolo[3,2-b]indole.
| Compound Name | 5,10-bis(2-ethylhexyl)-3,8-difluoro-2,7-bis[5-(5-hexylthiophen-2-yl)thiophen-2-yl]indolo[3,2-b]indole |
|---|---|
| PubChem CID | 153408881 |
| Molecular Formula | C58H72F2N2S4 |
| Molecular Weight | 963.49 g/mol |
| Exact Mass | 962.45 |
| IUPAC Name | 5,10-bis(2-ethylhexyl)-3,8-difluoro-2,7-bis[5-(5-hexylthiophen-2-yl)thiophen-2-yl]indolo[3,2-b]indole |
| SMILES | CCCCCCc1ccc(-c2ccc(-c3cc4c(cc3F)c3c(c5cc(F)c(-c6ccc(-c7ccc(CCCCCC)s7)s6)cc5n3CC(CC)CCCC)n4CC(CC)CCCC)s2)s1 |
| InChI | InChI=1S/C58H72F2N2S4/c1-7-13-17-19-23-41-25-27-53(63-41)55-31-29-51(65-55)43-35-49-45(33-47(43)59)57-58(61(49)37-39(11-5)21-15-9-3)46-34-48(60)44(36-50(46)62(57)38-40(12-6)22-16-10-4)52-30-32-56(66-52)54-28-26-42(64-54)24-20-18-14-8-2/h25-36,39-40H,7-24,37-38H2,1-6H3 |
| InChIKey | KGGJQJPUWUYNJY-UHFFFAOYSA-N |
| XLogP | 20.62 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 963.49 |
| LogP ≤ 5 | 20.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|