C74H104F2N2S4 — CID 163404662
2,7-bis[4-(2-ethylhexyl)-5-[5-(2-ethylhexyl)thiophen-2-yl]thiophen-2-yl]-3,8-difluoro-5,10-dihexylindolo[3,2-b]indole (PubChem CID 163404662) has the molecular formula C74H104F2N2S4 and a molecular weight of 1187.92 g/mol. Its IUPAC name is 2,7-bis[4-(2-ethylhexyl)-5-[5-(2-ethylhexyl)thiophen-2-yl]thiophen-2-yl]-3,8-difluoro-5,10-dihexylindolo[3,2-b]indole.
| Compound Name | 2,7-bis[4-(2-ethylhexyl)-5-[5-(2-ethylhexyl)thiophen-2-yl]thiophen-2-yl]-3,8-difluoro-5,10-dihexylindolo[3,2-b]indole |
|---|---|
| PubChem CID | 163404662 |
| Molecular Formula | C74H104F2N2S4 |
| Molecular Weight | 1187.92 g/mol |
| Exact Mass | 1186.71 |
| IUPAC Name | 2,7-bis[4-(2-ethylhexyl)-5-[5-(2-ethylhexyl)thiophen-2-yl]thiophen-2-yl]-3,8-difluoro-5,10-dihexylindolo[3,2-b]indole |
| SMILES | CCCCCCn1c2cc(-c3cc(CC(CC)CCCC)c(-c4ccc(CC(CC)CCCC)s4)s3)c(F)cc2c2c1c1cc(F)c(-c3cc(CC(CC)CCCC)c(-c4ccc(CC(CC)CCCC)s4)s3)cc1n2CCCCCC |
| InChI | InChI=1S/C74H104F2N2S4/c1-11-21-27-29-39-77-65-49-59(69-45-55(41-51(17-7)31-23-13-3)73(81-69)67-37-35-57(79-67)43-53(19-9)33-25-15-5)63(75)47-61(65)72-71(77)62-48-64(76)60(50-66(62)78(72)40-30-28-22-12-2)70-46-56(42-52(18-8)32-24-14-4)74(82-70)68-38-36-58(80-68)44-54(20-10)34-26-16-6/h35-38,45-54H,11-34,39-44H2,1-10H3 |
| InChIKey | YEZPMPAGEPHLLS-UHFFFAOYSA-N |
| XLogP | 26.14 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 82 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1187.92 |
| LogP ≤ 5 | 26.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|