C21H21F3N6O — CID 153410643
5-methyl-2-(triazol-2-yl)-N-[1-[[6-(trifluoromethyl)-3-pyridinyl]amino]cyclopentyl]benzamide (PubChem CID 153410643) has the molecular formula C21H21F3N6O and a molecular weight of 430.43 g/mol. Its IUPAC name is 5-methyl-2-(triazol-2-yl)-N-[1-[[6-(trifluoromethyl)-3-pyridinyl]amino]cyclopentyl]benzamide.
| Compound Name | 5-methyl-2-(triazol-2-yl)-N-[1-[[6-(trifluoromethyl)-3-pyridinyl]amino]cyclopentyl]benzamide |
|---|---|
| PubChem CID | 153410643 |
| Molecular Formula | C21H21F3N6O |
| Molecular Weight | 430.43 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | 5-methyl-2-(triazol-2-yl)-N-[1-[[6-(trifluoromethyl)-3-pyridinyl]amino]cyclopentyl]benzamide |
| SMILES | Cc1ccc(-n2nccn2)c(C(=O)NC2(Nc3ccc(C(F)(F)F)nc3)CCCC2)c1 |
| InChI | InChI=1S/C21H21F3N6O/c1-14-4-6-17(30-26-10-11-27-30)16(12-14)19(31)29-20(8-2-3-9-20)28-15-5-7-18(25-13-15)21(22,23)24/h4-7,10-13,28H,2-3,8-9H2,1H3,(H,29,31) |
| InChIKey | NLPCYDFOCMPILQ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.43 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|