C20H17InNO4 — CID 153410783
CID 153410783 (PubChem CID 153410783) has the molecular formula C20H17InNO4 and a molecular weight of 450.18 g/mol.
| Compound Name | CID 153410783 |
|---|---|
| PubChem CID | 153410783 |
| Molecular Formula | C20H17InNO4 |
| Molecular Weight | 450.18 g/mol |
| Exact Mass | 450.02 |
| IUPAC Name | — |
| SMILES | COc1cccc(Nc2ccccc2CC(=O)C2=C[In]C(C(=O)O)=C2)c1 |
| InChI | InChI=1S/C20H17NO4.In/c1-14(10-11-20(23)24)19(22)12-15-6-3-4-9-18(15)21-16-7-5-8-17(13-16)25-2;/h1,3-10,13,21H,12H2,2H3,(H,23,24); |
| InChIKey | WGDGJTUXMZWGFO-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.18 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |