C15H13NO5 — CID 15645729
6-(3-methoxyanilino)-1,3-benzodioxole-5-carboxylic acid (PubChem CID 15645729) has the molecular formula C15H13NO5 and a molecular weight of 287.27 g/mol. Its IUPAC name is 6-(3-methoxyanilino)-1,3-benzodioxole-5-carboxylic acid.
| Compound Name | 6-(3-methoxyanilino)-1,3-benzodioxole-5-carboxylic acid |
|---|---|
| PubChem CID | 15645729 |
| Molecular Formula | C15H13NO5 |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 6-(3-methoxyanilino)-1,3-benzodioxole-5-carboxylic acid |
| SMILES | COc1cccc(Nc2cc3c(cc2C(=O)O)OCO3)c1 |
| InChI | InChI=1S/C15H13NO5/c1-19-10-4-2-3-9(5-10)16-12-7-14-13(20-8-21-14)6-11(12)15(17)18/h2-7,16H,8H2,1H3,(H,17,18) |
| InChIKey | YRAIZXQLFPCVTK-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |