About 8-(difluoromethyl)-1,2-dihydropyrrolo[3,2-i]quinoline
8-(difluoromethyl)-1,2-dihydropyrrolo[3,2-i]quinoline (PubChem CID 153411019) has the molecular formula C12H10F2N2
and a molecular weight of 220.22 g/mol. Its IUPAC name is 8-(difluoromethyl)-1,2-dihydropyrrolo[3,2-i]quinoline.
Molecular Properties
| Compound Name | 8-(difluoromethyl)-1,2-dihydropyrrolo[3,2-i]quinoline |
| PubChem CID | 153411019 |
| Molecular Formula | C12H10F2N2 |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 8-(difluoromethyl)-1,2-dihydropyrrolo[3,2-i]quinoline |
| SMILES | FC(F)C1=CC2=CC=CC3=CCNC23N=C1 |
| InChI | InChI=1S/C12H10F2N2/c13-11(14)8-6-10-3-1-2-9-4-5-15-12(9,10)16-7-8/h1-4,6-7,11,15H,5H2 |
| InChIKey | JKBVDAVCCASNQG-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-(difluoromethyl)-1,2-dihydropyrrolo[3,2-i]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(difluoromethyl)-1,2-dihydropyrrolo[3,2-i]quinoline?
The IUPAC name of 8-(difluoromethyl)-1,2-dihydropyrrolo[3,2-i]quinoline (CID 153411019) is 8-(difluoromethyl)-1,2-dihydropyrrolo[3,2-i]quinoline.
What is the SMILES notation for 8-(difluoromethyl)-1,2-dihydropyrrolo[3,2-i]quinoline?
The canonical SMILES for 8-(difluoromethyl)-1,2-dihydropyrrolo[3,2-i]quinoline is FC(F)C1=CC2=CC=CC3=CCNC23N=C1.
What is the InChIKey of 8-(difluoromethyl)-1,2-dihydropyrrolo[3,2-i]quinoline?
The InChIKey is JKBVDAVCCASNQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10F2N2/c13-11(14)8-6-10-3-1-2-9-4-5-15-12(9,10)16-7-8/h1-4,6-7,11,15H,5H2.
What are the key properties of 8-(difluoromethyl)-1,2-dihydropyrrolo[3,2-i]quinoline?
8-(difluoromethyl)-1,2-dihydropyrrolo[3,2-i]quinoline has a molecular weight of 220.22 g/mol, XLogP of 1.98, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(difluoromethyl)-1,2-dihydropyrrolo[3,2-i]quinoline is sourced from PubChem (CID 153411019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).