About 4,4a-dihydro-3aH-pyrazolo[4,3-b][1,8]naphthyridine
4,4a-dihydro-3aH-pyrazolo[4,3-b][1,8]naphthyridine (PubChem CID 149253861) has the molecular formula C9H8N4
and a molecular weight of 172.19 g/mol. Its IUPAC name is 4,4a-dihydro-3aH-pyrazolo[4,3-b][1,8]naphthyridine.
Analyze 4,4a-dihydro-3aH-pyrazolo[4,3-b][1,8]naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4a-dihydro-3aH-pyrazolo[4,3-b][1,8]naphthyridine?
The IUPAC name of 4,4a-dihydro-3aH-pyrazolo[4,3-b][1,8]naphthyridine (CID 149253861) is 4,4a-dihydro-3aH-pyrazolo[4,3-b][1,8]naphthyridine.
What is the SMILES notation for 4,4a-dihydro-3aH-pyrazolo[4,3-b][1,8]naphthyridine?
The canonical SMILES for 4,4a-dihydro-3aH-pyrazolo[4,3-b][1,8]naphthyridine is C1=CC2=CC3=NN=CC3NC2N=C1.
What is the InChIKey of 4,4a-dihydro-3aH-pyrazolo[4,3-b][1,8]naphthyridine?
The InChIKey is ASLUDLGSDUKZRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N4/c1-2-6-4-7-8(5-11-13-7)12-9(6)10-3-1/h1-5,8-9,12H.
What are the key properties of 4,4a-dihydro-3aH-pyrazolo[4,3-b][1,8]naphthyridine?
4,4a-dihydro-3aH-pyrazolo[4,3-b][1,8]naphthyridine has a molecular weight of 172.19 g/mol, XLogP of 0.29, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4a-dihydro-3aH-pyrazolo[4,3-b][1,8]naphthyridine is sourced from PubChem (CID 149253861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).