C10H10N4 — CID 141411572
1,2-dihydropyrrolo[3,2-d][1,5]naphthyridin-7-amine (PubChem CID 141411572) has the molecular formula C10H10N4 and a molecular weight of 186.22 g/mol. Its IUPAC name is 1,2-dihydropyrrolo[3,2-d][1,5]naphthyridin-7-amine.
| Compound Name | 1,2-dihydropyrrolo[3,2-d][1,5]naphthyridin-7-amine |
|---|---|
| PubChem CID | 141411572 |
| Molecular Formula | C10H10N4 |
| Molecular Weight | 186.22 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | 1,2-dihydropyrrolo[3,2-d][1,5]naphthyridin-7-amine |
| SMILES | NC1=CN=C2C=CCNC23N=CC=C13 |
| InChI | InChI=1S/C10H10N4/c11-8-6-12-9-2-1-4-13-10(9)7(8)3-5-14-10/h1-3,5-6,13H,4,11H2 |
| InChIKey | CQQFVVVABJAQLU-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 62.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.22 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |