C10H9N3 — CID 118072746
2,5-dihydro-1H-pyrrolo[3,2-h]quinazoline (PubChem CID 118072746) has the molecular formula C10H9N3 and a molecular weight of 171.20 g/mol. Its IUPAC name is 2,5-dihydro-1H-pyrrolo[3,2-h]quinazoline.
| Compound Name | 2,5-dihydro-1H-pyrrolo[3,2-h]quinazoline |
|---|---|
| PubChem CID | 118072746 |
| Molecular Formula | C10H9N3 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.08 |
| IUPAC Name | 2,5-dihydro-1H-pyrrolo[3,2-h]quinazoline |
| SMILES | C1=CC2=CCC3=C(NCN=C3)C2=N1 |
| InChI | InChI=1S/C10H9N3/c1-2-8-5-11-6-13-10(8)9-7(1)3-4-12-9/h1,3-5,13H,2,6H2 |
| InChIKey | CEYKYGAGLNHXTP-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |