C23H35F3O5 — CID 153411367
[4-[(E)-3-oxo-3-propoxyprop-1-enyl]cyclohexyl] 4-(4,4,4-trifluorobutoxy)cyclohexane-1-carboxylate (PubChem CID 153411367) has the molecular formula C23H35F3O5 and a molecular weight of 448.52 g/mol. Its IUPAC name is [4-[(E)-3-oxo-3-propoxyprop-1-enyl]cyclohexyl] 4-(4,4,4-trifluorobutoxy)cyclohexane-1-carboxylate.
| Compound Name | [4-[(E)-3-oxo-3-propoxyprop-1-enyl]cyclohexyl] 4-(4,4,4-trifluorobutoxy)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 153411367 |
| Molecular Formula | C23H35F3O5 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | [4-[(E)-3-oxo-3-propoxyprop-1-enyl]cyclohexyl] 4-(4,4,4-trifluorobutoxy)cyclohexane-1-carboxylate |
| SMILES | CCCOC(=O)/C=C/C1CCC(OC(=O)C2CCC(OCCCC(F)(F)F)CC2)CC1 |
| InChI | InChI=1S/C23H35F3O5/c1-2-15-30-21(27)13-6-17-4-9-20(10-5-17)31-22(28)18-7-11-19(12-8-18)29-16-3-14-23(24,25)26/h6,13,17-20H,2-5,7-12,14-16H2,1H3/b13-6+ |
| InChIKey | GMVAEOLLMCKPPS-AWNIVKPZSA-N |
| XLogP | 5.52 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|