C16H28O3 — CID 91697646
[(E)-oct-3-en-2-yl] 4-methoxycyclohexane-1-carboxylate (PubChem CID 91697646) has the molecular formula C16H28O3 and a molecular weight of 268.40 g/mol. Its IUPAC name is [(E)-oct-3-en-2-yl] 4-methoxycyclohexane-1-carboxylate.
| Compound Name | [(E)-oct-3-en-2-yl] 4-methoxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 91697646 |
| Molecular Formula | C16H28O3 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | [(E)-oct-3-en-2-yl] 4-methoxycyclohexane-1-carboxylate |
| SMILES | CCCC/C=C/C(C)OC(=O)C1CCC(OC)CC1 |
| InChI | InChI=1S/C16H28O3/c1-4-5-6-7-8-13(2)19-16(17)14-9-11-15(18-3)12-10-14/h7-8,13-15H,4-6,9-12H2,1-3H3/b8-7+ |
| InChIKey | HFKFWRJBXAKLLU-BQYQJAHWSA-N |
| XLogP | 3.87 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|