C35H28N6O — CID 153411451
6-[9-(4-tert-butyl-2-pyridinyl)carbazol-2-yl]oxy-11-methyltetrazolo[1,5-f]phenanthridine (PubChem CID 153411451) has the molecular formula C35H28N6O and a molecular weight of 548.65 g/mol. Its IUPAC name is 6-[9-(4-tert-butyl-2-pyridinyl)carbazol-2-yl]oxy-11-methyltetrazolo[1,5-f]phenanthridine.
| Compound Name | 6-[9-(4-tert-butyl-2-pyridinyl)carbazol-2-yl]oxy-11-methyltetrazolo[1,5-f]phenanthridine |
|---|---|
| PubChem CID | 153411451 |
| Molecular Formula | C35H28N6O |
| Molecular Weight | 548.65 g/mol |
| Exact Mass | 548.23 |
| IUPAC Name | 6-[9-(4-tert-butyl-2-pyridinyl)carbazol-2-yl]oxy-11-methyltetrazolo[1,5-f]phenanthridine |
| SMILES | Cc1ccc2c3ccc(Oc4ccc5c6ccccc6n(-c6cc(C(C)(C)C)ccn6)c5c4)cc3n3nnnc3c2c1 |
| InChI | InChI=1S/C35H28N6O/c1-21-9-12-25-27-13-10-24(20-32(27)41-34(29(25)17-21)37-38-39-41)42-23-11-14-28-26-7-5-6-8-30(26)40(31(28)19-23)33-18-22(15-16-36-33)35(2,3)4/h5-20H,1-4H3 |
| InChIKey | HPFVOQDABUOOSG-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 70.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.65 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|