C39H27FN6O — CID 153411711
10-fluoro-11-(5-pyridin-2-ylpyrido[4,3-b]indol-3-yl)oxy-3-(2,4,6-trimethylphenyl)-[1,2,4]triazolo[4,3-f]phenanthridine (PubChem CID 153411711) has the molecular formula C39H27FN6O and a molecular weight of 614.68 g/mol. Its IUPAC name is 10-fluoro-11-(5-pyridin-2-ylpyrido[4,3-b]indol-3-yl)oxy-3-(2,4,6-trimethylphenyl)-[1,2,4]triazolo[4,3-f]phenanthridine.
| Compound Name | 10-fluoro-11-(5-pyridin-2-ylpyrido[4,3-b]indol-3-yl)oxy-3-(2,4,6-trimethylphenyl)-[1,2,4]triazolo[4,3-f]phenanthridine |
|---|---|
| PubChem CID | 153411711 |
| Molecular Formula | C39H27FN6O |
| Molecular Weight | 614.68 g/mol |
| Exact Mass | 614.22 |
| IUPAC Name | 10-fluoro-11-(5-pyridin-2-ylpyrido[4,3-b]indol-3-yl)oxy-3-(2,4,6-trimethylphenyl)-[1,2,4]triazolo[4,3-f]phenanthridine |
| SMILES | Cc1cc(C)c(-c2nnc3c4cc(Oc5cc6c(cn5)c5ccccc5n6-c5ccccn5)c(F)cc4c4ccccc4n23)c(C)c1 |
| InChI | InChI=1S/C39H27FN6O/c1-22-16-23(2)37(24(3)17-22)39-44-43-38-28-19-34(30(40)18-27(28)25-10-4-7-13-32(25)46(38)39)47-36-20-33-29(21-42-36)26-11-5-6-12-31(26)45(33)35-14-8-9-15-41-35/h4-21H,1-3H3 |
| InChIKey | YRGDAQNFNZJWBU-UHFFFAOYSA-N |
| XLogP | 9.45 |
| TPSA | 70.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.68 |
| LogP ≤ 5 | 9.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|