C17H21N4O2+ — CID 153412254
3-[[5-(2-hydroxypropyl)-4-(1-methyl-3H-pyrazol-1-ium-5-yl)imidazol-1-yl]methyl]phenol (PubChem CID 153412254) has the molecular formula C17H21N4O2+ and a molecular weight of 313.38 g/mol. Its IUPAC name is 3-[[5-(2-hydroxypropyl)-4-(1-methyl-3H-pyrazol-1-ium-5-yl)imidazol-1-yl]methyl]phenol.
| Compound Name | 3-[[5-(2-hydroxypropyl)-4-(1-methyl-3H-pyrazol-1-ium-5-yl)imidazol-1-yl]methyl]phenol |
|---|---|
| PubChem CID | 153412254 |
| Molecular Formula | C17H21N4O2+ |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | 3-[[5-(2-hydroxypropyl)-4-(1-methyl-3H-pyrazol-1-ium-5-yl)imidazol-1-yl]methyl]phenol |
| SMILES | CC(O)Cc1c(C2=CCN=[N+]2C)ncn1Cc1cccc(O)c1 |
| InChI | InChI=1S/C17H20N4O2/c1-12(22)8-16-17(15-6-7-19-20(15)2)18-11-21(16)10-13-4-3-5-14(23)9-13/h3-6,9,11-12,22H,7-8,10H2,1-2H3/p+1 |
| InChIKey | RQSXAGJKMNDOMP-UHFFFAOYSA-O |
| XLogP | 2.01 |
| TPSA | 73.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|